EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176499 - ML162
| Formula | C23H22Cl2N2O3S |
| Net Charge | 0 |
| Average Mass | 477.413 |
| Monoisotopic Mass | 476.07282 |
| SMILES | COc1ccc(N(C(=O)CCl)C(C(=O)NCCc2ccccc2)c2cccs2)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O3S/c1-30-19-10-9-17(14-18(19)25)27(21(28)15-24)22(20-8-5-13-31-20)23(29)26-12-11-16-6-3-2-4-7-16/h2-10,13-14,22H,11-12,15H2,1H3,(H,26,29) |
| InChIKey | UNVKYJSNMVDZJE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.11.1.9 (glutathione peroxidase) inhibitor An inhibitor of peroxidases (EC 1.11.1.*) that inhibits the action of glutathione peroxidase (EC 1.11.1.9). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ML162 (CHEBI:176499) has role EC 1.11.1.9 (glutathione peroxidase) inhibitor (CHEBI:176342) |
| ML162 (CHEBI:176499) has role ferroptosis inducer (CHEBI:173085) |
| ML162 (CHEBI:176499) is a monochlorobenzenes (CHEBI:83403) |
| ML162 (CHEBI:176499) is a monomethoxybenzene (CHEBI:25235) |
| ML162 (CHEBI:176499) is a organochlorine compound (CHEBI:36683) |
| ML162 (CHEBI:176499) is a secondary carboxamide (CHEBI:140325) |
| ML162 (CHEBI:176499) is a tertiary carboxamide (CHEBI:140326) |
| ML162 (CHEBI:176499) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 2-chloro-N-(3-chloro-4-methoxyphenyl)-N-{2-oxo-2-[(2-phenylethyl)amino]-1-(thiophen-2-yl)ethyl}acetamide |
| Synonyms | Source |
|---|---|
| DPI7 | ChEBI |
| ML 162 | ChEBI |
| ML-162 | ChEBI |
| Molecular Libraries 162 | ChEBI |
| Citations |
|---|