EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O8S |
| Net Charge | 0 |
| Average Mass | 264.211 |
| Monoisotopic Mass | 263.99399 |
| SMILES | COc1c(O)cc(C(=O)O)cc1OS(=O)(=O)O |
| InChI | InChI=1S/C8H8O8S/c1-15-7-5(9)2-4(8(10)11)3-6(7)16-17(12,13)14/h2-3,9H,1H3,(H,10,11)(H,12,13,14) |
| InChIKey | LMJIEJLSDJBABY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylgallic O-sulfate (CHEBI:176487) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| 3-hydroxy-4-methoxy-5-sulooxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9000783 | ChemSpider |