EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O7S |
| Net Charge | 0 |
| Average Mass | 248.212 |
| Monoisotopic Mass | 247.99907 |
| SMILES | COc1ccc(C(=O)O)cc1OS(=O)(=O)O |
| InChI | InChI=1S/C8H8O7S/c1-14-6-3-2-5(8(9)10)4-7(6)15-16(11,12)13/h2-4H,1H3,(H,9,10)(H,11,12,13) |
| InChIKey | VSFFJSSUGMYRMP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxy-3-(sulfooxy)benzoic acid (CHEBI:176483) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 4-methoxy-3-sulooxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74854161 | ChemSpider |
| HMDB0140929 | HMDB |