EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H21N2O2 |
| Net Charge | +1 |
| Average Mass | 189.279 |
| Monoisotopic Mass | 189.15975 |
| SMILES | C[N+](C)(C)CCCCC(N)C(=O)O |
| InChI | InChI=1S/C9H20N2O2/c1-11(2,3)7-5-4-6-8(10)9(12)13/h8H,4-7,10H2,1-3H3/p+1 |
| InChIKey | MXNRLFUSFKVQSK-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N,N-Trimethyllysine (CHEBI:176482) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (5-amino-5-carboxypentyl)-trimethylazanium |
| Manual Xrefs | Databases |
|---|---|
| 140380 | ChemSpider |