EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO6 |
| Net Charge | 0 |
| Average Mass | 205.166 |
| Monoisotopic Mass | 205.05864 |
| SMILES | O=C(O)CCC(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C7H11NO6/c9-3-4(7(13)14)8-5(10)1-2-6(11)12/h4,9H,1-3H2,(H,8,10)(H,11,12)(H,13,14)/t4-/m0/s1 |
| InChIKey | APLLXBUUNCLPCL-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Succinylserine (CHEBI:176470) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 4-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62991130 | ChemSpider |