EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO3 |
| Net Charge | 0 |
| Average Mass | 223.272 |
| Monoisotopic Mass | 223.12084 |
| SMILES | CN(C)[C@@](C)(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C12H17NO3/c1-12(11(15)16,13(2)3)8-9-4-6-10(14)7-5-9/h4-7,14H,8H2,1-3H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | KOHIPRUAATWABH-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trimethyltyrosine (CHEBI:176469) is a benzenes (CHEBI:22712) |
| Trimethyltyrosine (CHEBI:176469) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)-2-methylpropanoic acid |