EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO5 |
| Net Charge | 0 |
| Average Mass | 261.318 |
| Monoisotopic Mass | 261.15762 |
| SMILES | CC(C)CC(=O)C(O)(CC(=O)[O-])C(O)[N+](C)(C)C |
| InChI | InChI=1S/C12H23NO5/c1-8(2)6-9(14)12(18,7-10(15)16)11(17)13(3,4)5/h8,11,17-18H,6-7H2,1-5H3 |
| InChIKey | OTUSSJGEYNMECS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxyisovalerylcarnitine (CHEBI:176464) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 3-hydroxy-3-[hydroxy-(trimethylazaniumyl)methyl]-6-methyl-4-oxoheptanoate |
| Manual Xrefs | Databases |
|---|---|
| 67171081 | ChemSpider |