EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O4 |
| Net Charge | 0 |
| Average Mass | 254.286 |
| Monoisotopic Mass | 254.12666 |
| SMILES | O=C(O)C1CCC(C2CCCC(C(=O)O)N2)=CN1 |
| InChI | InChI=1S/C12H18N2O4/c15-11(16)9-5-4-7(6-13-9)8-2-1-3-10(14-8)12(17)18/h6,8-10,13-14H,1-5H2,(H,15,16)(H,17,18) |
| InChIKey | FZNMMFIPIGBAJL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aldosine (CHEBI:176457) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 5-(6-carboxypiperidin-2-yl)-1,2,3,4-tetrahydropyridine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 28686448 | ChemSpider |
| HMDB0037817 | HMDB |