EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | CC(CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-3(5(8)9)2-4(7)6(10)11/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | KRKRAOXTGDJWNI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylglutamic acid (CHEBI:176455) is a amino dicarboxylic acid (CHEBI:36164) |
| 4-methylglutamic acid (CHEBI:176455) is a glutamic acid derivative (CHEBI:24315) |
| Incoming Relation(s) |
| 4-methyl-L-glutamic acid (CHEBI:20440) is a 4-methylglutamic acid (CHEBI:176455) |
| IUPAC Name |
|---|
| 4-methylglutamic acid |
| Synonyms | Source |
|---|---|
| 2-amino-4-methylpentanedioic acid | IUPAC |
| γ-methylglutamic acid | ChEBI |
| 2-amino-4-methyl-pentanedioic acid | ChEBI |
| 2-amino-4-methylglutaric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5172 | ChemSpider |
| HMDB0341425 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:14561-55-8 | ChEBI |
| Citations |
|---|