EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7FO2 |
| Net Charge | 0 |
| Average Mass | 166.151 |
| Monoisotopic Mass | 166.04301 |
| SMILES | O=C(O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C9H7FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/b6-3+ |
| InChIKey | ISMMYAZSUSYVQG-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS2295) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Fluorocinnamic acid (CHEBI:176440) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| (E)-3-(4-luorophenyl)prop-2-enoic acid |