EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O4 |
| Net Charge | 0 |
| Average Mass | 184.191 |
| Monoisotopic Mass | 184.07356 |
| SMILES | CCCc1occ(CO)c1C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-2-3-7-8(9(11)12)6(4-10)5-13-7/h5,10H,2-4H2,1H3,(H,11,12) |
| InChIKey | JAAQAAFKQSNUEH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces coelicolor A3(2) (ncbitaxon:100226) | - | PubMed (18988741) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (18988741) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(hydroxymethyl)-2-propylfuran-3-carboxylic acid (CHEBI:176426) has role bacterial metabolite (CHEBI:76969) |
| 4-(hydroxymethyl)-2-propylfuran-3-carboxylic acid (CHEBI:176426) is a aromatic primary alcohol (CHEBI:33857) |
| 4-(hydroxymethyl)-2-propylfuran-3-carboxylic acid (CHEBI:176426) is a furans (CHEBI:24129) |
| 4-(hydroxymethyl)-2-propylfuran-3-carboxylic acid (CHEBI:176426) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 4-(hydroxymethyl)-2-propylfuran-3-carboxylic acid |
| Synonym | Source |
|---|---|
| MMF2 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LUB | PDBeChem |
| Citations |
|---|