EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H38N4O4 |
| Net Charge | -2 |
| Average Mass | 578.713 |
| Monoisotopic Mass | 578.29040 |
| SMILES | CCC1=C(C)c2cc3c(CC)c(C)c(cc4nc(cc5nc(cc1n2)c(C)c5CCC(=O)[O-])C(CCC(=O)[O-])=C4C)n3C |
| InChI | InChI=1S/C35H40N4O4/c1-8-22-18(3)28-17-33-23(9-2)21(6)32(39(33)7)16-27-20(5)25(11-13-35(42)43)31(38-27)15-30-24(10-12-34(40)41)19(4)26(36-30)14-29(22)37-28/h14-17,36H,8-13H2,1-7H3,(H,40,41)(H,42,43)/p-2/b26-14-,27-16-,28-17-,29-14-,30-15-,31-15-,32-16-,33-17- |
| InChIKey | YNWHQWMCLCANDI-YIYRCNGCSA-L |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylmesoporphyrin(2−) (CHEBI:176424) is a dicarboxylic acid dianion (CHEBI:28965) |
| N-methylmesoporphyrin(2−) (CHEBI:176424) is a mesoporphyrins (CHEBI:59559) |
| N-methylmesoporphyrin(2−) (CHEBI:176424) is conjugate base of N-methylmesoporphyrin (CHEBI:44085) |
| Incoming Relation(s) |
| N-methylmesoporphyrin (CHEBI:44085) is conjugate acid of N-methylmesoporphyrin(2−) (CHEBI:176424) |
| Synonym | Source |
|---|---|
| N-methylmesoporphyrin dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| N-methylmesoporphyrin | UniProt |