EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N3O3S2 |
| Net Charge | 0 |
| Average Mass | 447.626 |
| Monoisotopic Mass | 447.16503 |
| SMILES | CCc1ccc(/C=C2\SC(=S)N(CCC(=O)NCCCN3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C22H29N3O3S2/c1-2-17-4-6-18(7-5-17)16-19-21(27)25(22(29)30-19)11-8-20(26)23-9-3-10-24-12-14-28-15-13-24/h4-7,16H,2-3,8-15H2,1H3,(H,23,26)/b19-16- |
| InChIKey | YGWYOVIFRLGRKC-MNDPQUGUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DPI2 (CHEBI:176422) has role ferroptosis inducer (CHEBI:173085) |
| DPI2 (CHEBI:176422) is a benzenes (CHEBI:22712) |
| DPI2 (CHEBI:176422) is a morpholines (CHEBI:38785) |
| DPI2 (CHEBI:176422) is a secondary carboxamide (CHEBI:140325) |
| DPI2 (CHEBI:176422) is a tertiary amino compound (CHEBI:50996) |
| DPI2 (CHEBI:176422) is a thiazolidinone (CHEBI:48891) |
| IUPAC Name |
|---|
| 3-[(5Z)-5-(4-ethylbenzylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[3-(morpholin-4-yl)propyl]propanamide |
| Manual Xrefs | Databases |
|---|---|
| US20150175558 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:356572-72-0 | ChEBI |
| Citations |
|---|