EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25ClFNO4 |
| Net Charge | 0 |
| Average Mass | 469.940 |
| Monoisotopic Mass | 469.14561 |
| SMILES | [H][C@@]1(c2ccc(Cl)cc2)CC(=O)C2=C(C1)NC(C)=C(C(=O)OCCOC)[C@@]2([H])c1ccccc1F |
| InChI | InChI=1S/C26H25ClFNO4/c1-15-23(26(31)33-12-11-32-2)24(19-5-3-4-6-20(19)28)25-21(29-15)13-17(14-22(25)30)16-7-9-18(27)10-8-16/h3-10,17,24,29H,11-14H2,1-2H3/t17-,24+/m0/s1 |
| InChIKey | WFRKCJJZTFUDRP-BXKMTCNYSA-N |
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. voltage-dependent anion channel inhibitor Any agent that inhibits voltage-dependent anion channels. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RSL5 (CHEBI:176418) has role antineoplastic agent (CHEBI:35610) |
| RSL5 (CHEBI:176418) has role ferroptosis inducer (CHEBI:173085) |
| RSL5 (CHEBI:176418) has role voltage-dependent anion channel inhibitor (CHEBI:173100) |
| RSL5 (CHEBI:176418) is a 2-methoxyethyl ester (CHEBI:136838) |
| RSL5 (CHEBI:176418) is a monochlorobenzenes (CHEBI:83403) |
| RSL5 (CHEBI:176418) is a monofluorobenzenes (CHEBI:83575) |
| RSL5 (CHEBI:176418) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 2-methoxyethyl (4S,7S)-7-(4-chlorophenyl)-4-(2-fluorophenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Citations |
|---|