EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO4 |
| Net Charge | 0 |
| Average Mass | 211.217 |
| Monoisotopic Mass | 211.08446 |
| SMILES | O=C(O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13NO4/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)15/h5-6H,1-4,7H2,(H,14,15) |
| InChIKey | WOJKKJKETHYEAC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2782) | Strain: ICR Mouse [NCIT:C37408] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Maleimidocaproic acid (CHEBI:176414) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 6-(2,5-dioxopyrrol-1-yl)hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 498795 | ChemSpider |