EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O3 |
| Net Charge | 0 |
| Average Mass | 372.549 |
| Monoisotopic Mass | 372.26645 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C([C@H](C)CCC(=O)O)=CC[C@@]21[H] |
| InChI | InChI=1S/C24H36O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h5,7,15,17-18,20-21,25H,4,6,8-14H2,1-3H3,(H,26,27)/t15-,17+,18+,20+,21+,23+,24-/m1/s1 |
| InChIKey | DEQAPBOSYFPJKQ-IMRKFHMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2782) | Strain: ICR Mouse [NCIT:C37408] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3beta-Hydroxychola-5,16-dien-24-oic Acid (CHEBI:176410) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4447265 | ChemSpider |
| LMST04010436 | LIPID MAPS |