EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O8 |
| Net Charge | 0 |
| Average Mass | 414.410 |
| Monoisotopic Mass | 414.13147 |
| SMILES | COc1cc(/C=C/C(=O)C(O)(C(=O)/C=C/c2ccc(O)cc2)C(O)CO)ccc1O |
| InChI | InChI=1S/C22H22O8/c1-30-18-12-15(4-9-17(18)25)6-11-20(27)22(29,21(28)13-23)19(26)10-5-14-2-7-16(24)8-3-14/h2-12,21,23-25,28-29H,13H2,1H3/b10-5+,11-6+ |
| InChIKey | JHDAVTOBIFNIPF-YOYBCKCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | leaf (BTO:0000713) | MetaboLights (MTBLS2566) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Coumaroyl-feruloylglycerol (CHEBI:176383) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1E,6E)-4-(1,2-dihydroxyethyl)-4-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |