EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N2O5 |
| Net Charge | 0 |
| Average Mass | 410.470 |
| Monoisotopic Mass | 410.18417 |
| SMILES | COc1cc(/C=C/C(=O)N(CCCCN)C(=O)/C=C/c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C23H26N2O5/c1-30-21-16-18(6-11-20(21)27)8-13-23(29)25(15-3-2-14-24)22(28)12-7-17-4-9-19(26)10-5-17/h4-13,16,26-27H,2-3,14-15,24H2,1H3/b12-7+,13-8+ |
| InChIKey | LKSSMIRTSULHLU-INOXDZRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | leaf (BTO:0000713) | MetaboLights (MTBLS2566) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Coumaroyl feruloylputrescine (CHEBI:176356) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-N-(4-aminobutyl)-N-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-3-(4-hydroxyphenyl)prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 67167188 | ChemSpider |