EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N2O3 |
| Net Charge | 0 |
| Average Mass | 322.364 |
| Monoisotopic Mass | 322.13174 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)NCCc1cnc2ccccc12 |
| InChI | InChI=1S/C19H18N2O3/c22-17-7-5-13(11-18(17)23)6-8-19(24)20-10-9-14-12-21-16-4-2-1-3-15(14)16/h1-8,11-12,21-23H,9-10H2,(H,20,24)/b8-6+ |
| InChIKey | LNKPAQNDSCOUPS-SOFGYWHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | leaf (BTO:0000713) | MetaboLights (MTBLS2566) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Caffeoyltryptamine (CHEBI:176347) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(3,4-dihydroxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 20578958 | ChemSpider |