EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O2 |
| Net Charge | 0 |
| Average Mass | 364.489 |
| Monoisotopic Mass | 364.21508 |
| SMILES | O=C(O)c1ccc(CN2CCC(CN[C@@H]3C[C@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O2/c26-23(27)20-8-6-18(7-9-20)16-25-12-10-17(11-13-25)15-24-22-14-21(22)19-4-2-1-3-5-19/h1-9,17,21-22,24H,10-16H2,(H,26,27)/t21-,22+/m0/s1 |
| InChIKey | LRULVYSBRWUVGR-FCHUYYIVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.14.99.66 (lysine-specific histone demethylase 1A) inhibitor An EC 1.14.99.* (miscellaneous oxidoreductase acting on paired donors, with incorporation or reduction of molecular oxygen) inhibitor that interferes with the action of lysine-specific histone demethylase 1A (EC 1.14.99.66). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK2879552 (CHEBI:176334) has role antineoplastic agent (CHEBI:35610) |
| GSK2879552 (CHEBI:176334) has role EC 1.14.99.66 (lysine-specific histone demethylase 1A) inhibitor (CHEBI:131509) |
| GSK2879552 (CHEBI:176334) is a benzenes (CHEBI:22712) |
| GSK2879552 (CHEBI:176334) is a benzoic acids (CHEBI:22723) |
| GSK2879552 (CHEBI:176334) is a cyclopropanes (CHEBI:51454) |
| GSK2879552 (CHEBI:176334) is a monocarboxylic acid (CHEBI:25384) |
| GSK2879552 (CHEBI:176334) is a piperidines (CHEBI:26151) |
| GSK2879552 (CHEBI:176334) is a secondary amino compound (CHEBI:50995) |
| GSK2879552 (CHEBI:176334) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-{[4-({[(1R,2S)-2-phenylcyclopropyl]amino}methyl)piperidin-1-yl]methyl}benzoic acid |
| Synonyms | Source |
|---|---|
| GSK 2879552 | ChEBI |
| GSK-2879552 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 35308350 | ChemSpider |
| WO2012135113 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1401966-69-5 | ChemIDplus |
| Citations |
|---|