EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29NO9 |
| Net Charge | 0 |
| Average Mass | 463.483 |
| Monoisotopic Mass | 463.18423 |
| SMILES | CN1CCC23c4c5ccc(OC6OC(C(=O)O)C(O)C(O)C6O)c4OC2[C@H](O)CCC3C1C5 |
| InChI | InChI=1S/C23H29NO9/c1-24-7-6-23-10-3-4-12(25)20(23)32-18-13(5-2-9(14(18)23)8-11(10)24)31-22-17(28)15(26)16(27)19(33-22)21(29)30/h2,5,10-12,15-17,19-20,22,25-28H,3-4,6-8H2,1H3,(H,29,30)/t10?,11?,12-,15?,16?,17?,19?,20?,22?,23?/m1/s1 |
| InChIKey | KCPRJVDBLLJBMF-LGPQXENESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydroisomorphine-3-glucuronide (CHEBI:176333) is a morphinane alkaloid (CHEBI:25418) |
| IUPAC Name |
|---|
| 3,4,5-trihydroxy-6-[[(7R)-7-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzouro[3,2-e]isoquinolin-9-yl]oxy]oxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060820 | HMDB |