EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H60O7 |
| Net Charge | 0 |
| Average Mass | 724.979 |
| Monoisotopic Mass | 724.43390 |
| SMILES | COc1ccc(C(=O)OCC2(C)CCC3(C)CCC4(C)C5=C(CCC4(C)C3C2)C2(C)CCC(OC(=O)c3ccc(OC)cc3)C(C)(C)C2CC5=O)cc1 |
| InChI | InChI=1S/C46H60O7/c1-41(2)35-26-34(47)38-33(44(35,5)20-19-37(41)53-40(49)30-12-16-32(51-9)17-13-30)18-21-45(6)36-27-42(3,22-23-43(36,4)24-25-46(38,45)7)28-52-39(48)29-10-14-31(50-8)15-11-29/h10-17,35-37H,18-28H2,1-9H3 |
| InChIKey | XIPDKLJUGQQUJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bis(4-methoxybenzoyl)-3a,29-dihydroxy-8-multifloren-7-one (CHEBI:176301) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [10-(4-methoxybenzoyl)oxy-2,4a,6a,9,9,12a,14a-heptamethyl-7-oxo-3,4,5,6,8,8a,10,11,12,13,14,14b-dodecahydro-1H-picen-2-yl]methyl 4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 35014908 | ChemSpider |
| HMDB0039970 | HMDB |