EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H60O9 |
| Net Charge | 0 |
| Average Mass | 648.878 |
| Monoisotopic Mass | 648.42373 |
| SMILES | COC1OC23C=CC4C1(CCC1(C)C(C(C)C/C=C/C(C)(C)O)CCC41C)C2CCC(OC1OC(CO)C(O)C(O)C1O)C3(C)C |
| InChI | InChI=1S/C37H60O9/c1-21(10-9-15-32(2,3)42)22-13-16-35(7)24-14-17-37-25(36(24,31(43-8)46-37)19-18-34(22,35)6)11-12-26(33(37,4)5)45-30-29(41)28(40)27(39)23(20-38)44-30/h9,14-15,17,21-31,38-42H,10-13,16,18-20H2,1-8H3/b15-9+ |
| InChIKey | VTWHHBJKZZJDQM-OQLLNIDSSA-N |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Goyaglycoside a (CHEBI:176277) is a cucurbitacin (CHEBI:16219) |
| Goyaglycoside a (CHEBI:176277) is a glycoside (CHEBI:24400) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)-6-[[8-[(E)-6-hydroxy-6-methylhept-4-en-2-yl]-19-methoxy-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-yl]oxy]oxane-3,4,5-triol |
| Manual Xrefs | Databases |
|---|---|
| 74886466 | ChemSpider |
| HMDB0038348 | HMDB |