EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O8 |
| Net Charge | 0 |
| Average Mass | 502.604 |
| Monoisotopic Mass | 502.25667 |
| SMILES | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CC=C3C4CC5OC6CC(=O)C(C)(C4CCC32C)C5(O)C6O)C1 |
| InChI | InChI=1S/C28H38O8/c1-13-10-20(36-23(31)14(13)2)26(5,32)27(33)9-7-16-15-11-21-28(34)22(30)18(35-21)12-19(29)25(28,4)17(15)6-8-24(16,27)3/h7,15,17-18,20-22,30,32-34H,6,8-12H2,1-5H3 |
| InChIKey | YZKXYOSYQKJNOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Withaperuvin F (CHEBI:176194) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 7-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-7,16,17-trihydroxy-8,12-dimethyl-18-oxapentacyclo[13.2.1.03,11.04,8.012,17]octadec-4-en-13-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034400 | HMDB |