EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O8 |
| Net Charge | 0 |
| Average Mass | 502.604 |
| Monoisotopic Mass | 502.25667 |
| SMILES | [H][C@@]12C[C@@]3([H])O[C@]34[C@@H](O)C=CC(=O)[C@]4(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@@]3(OC(=O)[C@H](C)[C@H]3C)[C@@H](O)[C@](C)(O)[C@]12[H] |
| InChI | InChI=1S/C28H38O8/c1-12-13(2)28(36-22(12)31)23(32)26(5,33)21-17(34-28)11-16-14-10-20-27(35-20)19(30)7-6-18(29)25(27,4)15(14)8-9-24(16,21)3/h6-7,12-17,19-21,23,30,32-33H,8-11H2,1-5H3/t12-,13-,14-,15+,16+,17+,19+,20-,21+,23+,24+,25+,26-,27-,28+/m1/s1 |
| InChIKey | RJARWAVNDSGUGC-JSAVSUPBSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ixocarpalactone B (CHEBI:176192) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1S,2S,3'R,4S,4'R,6S,7S,8R,9R,10S,13S,14R,18S,19R,21R)-7,8,18-trihydroxy-3',4',8,10,14-pentamethylspiro[5,20-dioxahexacyclo[11.9.0.02,10.04,9.014,19.019,21]docos-16-ene-6,5'-oxolane]-2',15-dione |
| Manual Xrefs | Databases |
|---|---|
| 10284644 | ChemSpider |