EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O2 |
| Net Charge | 0 |
| Average Mass | 272.348 |
| Monoisotopic Mass | 272.15248 |
| SMILES | CC(C)=CCc1cccc2ncc(C[C@H](N)C(=O)O)c12 |
| InChI | InChI=1S/C16H20N2O2/c1-10(2)6-7-11-4-3-5-14-15(11)12(9-18-14)8-13(17)16(19)20/h3-6,9,13,18H,7-8,17H2,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | MZSPRSJAOSKAAT-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(3-methylbut-2-enyl)-L-tryptophan (CHEBI:17619) is a L-tryptophan derivative (CHEBI:47994) |
| 4-(3-methylbut-2-enyl)-L-tryptophan (CHEBI:17619) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-(3-methylbut-2-enyl)-L-tryptophan (CHEBI:17619) is tautomer of 4-(3-methylbut-2-enyl)-L-tryptophan zwitterion (CHEBI:58209) |
| Incoming Relation(s) |
| 4-(3-methylbut-2-enyl)-L-tryptophan zwitterion (CHEBI:58209) is tautomer of 4-(3-methylbut-2-enyl)-L-tryptophan (CHEBI:17619) |
| IUPAC Name |
|---|
| 4-(3-methylbut-2-en-1-yl)-L-tryptophan |
| Synonyms | Source |
|---|---|
| 4-(3-methylbut-2-enyl)-L-tryptophan | ChEBI |
| 4-(3-Methylbut-2-enyl)-L-tryptophan | KEGG COMPOUND |