EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O8 |
| Net Charge | 0 |
| Average Mass | 502.604 |
| Monoisotopic Mass | 502.25667 |
| SMILES | [H][C@]12CC[C@]3(C)[C@](O)([C@@](C)(O)[C@@]4([H])CC(CO)=C(C)C(=O)O4)CC[C@@]3(O)[C@]1([H])C[C@@]1([H])O[C@]13CC=CC(=O)[C@]23C |
| InChI | InChI=1S/C28H38O8/c1-15-16(14-29)12-20(35-22(15)31)25(4,32)28(34)11-10-26(33)18-13-21-27(36-21)8-5-6-19(30)24(27,3)17(18)7-9-23(26,28)2/h5-6,17-18,20-21,29,32-34H,7-14H2,1-4H3/t17-,18+,20+,21+,23-,24-,25-,26+,27+,28-/m0/s1 |
| InChIKey | SGTFNLMVIRZWTA-LFCBYZEKSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 28-Hydroxywithanolide E (CHEBI:176187) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1S,2R,7S,9R,11R,12R,15S,16S)-12,15-dihydroxy-15-[(1S)-1-hydroxy-1-[(2R)-4-(hydroxymethyl)-5-methyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 103885328 | ChemSpider |