EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N4O6 |
| Net Charge | 0 |
| Average Mass | 378.385 |
| Monoisotopic Mass | 378.15393 |
| SMILES | Cc1cc2c(cc1C)N(C[C@H](O)[C@H](O)[C@H](O)CO)c1nc(=O)nc(=O)c1N2 |
| InChI | InChI=1S/C17H22N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,18,22-25H,5-6H2,1-2H3,(H2,19,20,26,27)/t11-,12+,14-/m0/s1 |
| InChIKey | SGSVWAYHEWEQET-SCRDCRAPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,5-dihydroriboflavin (CHEBI:17607) is a 1,5-dihydroflavin (CHEBI:62787) |
| 1,5-dihydroriboflavin (CHEBI:17607) is a dihydroriboflavins (CHEBI:15031) |
| 1,5-dihydroriboflavin (CHEBI:17607) is tautomer of 4a,5-dihydroriboflavin (CHEBI:8798) |
| Incoming Relation(s) |
| 4a,5-dihydroriboflavin (CHEBI:8798) is tautomer of 1,5-dihydroriboflavin (CHEBI:17607) |
| IUPAC Name |
|---|
| 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-1,3,4,5-tetrahydrobenzo[g]pteridin-10(2H)-yl)-D-ribitol |
| Synonym | Source |
|---|---|
| Reduced riboflavin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| reduced riboflavin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01007 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1232017 | Beilstein |