EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO10 |
| Net Charge | 0 |
| Average Mass | 427.406 |
| Monoisotopic Mass | 427.14785 |
| SMILES | N#CC(OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O)c1ccccc1 |
| InChI | InChI=1S/C19H25NO10/c20-6-11(9-4-2-1-3-5-9)29-19-17(26)15(24)14(23)12(30-19)8-28-18-16(25)13(22)10(21)7-27-18/h1-5,10-19,21-26H,7-8H2 |
| InChIKey | YYYCJNDALLBNEG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lucuminoside (CHEBI:176069) is a cyanogenic glycoside (CHEBI:23436) |
| IUPAC Name |
|---|
| 2-phenyl-2-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxyacetonitrile |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029900 | HMDB |
| 3673923 | ChemSpider |