EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34N4O10S |
| Net Charge | 0 |
| Average Mass | 558.610 |
| Monoisotopic Mass | 558.19956 |
| SMILES | CCC1(C)Oc2cc(c(S(=O)CCO)cc2O)C(O)C(NC)C(=O)NC(C)C(=O)NC1C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H34N4O10S/c1-5-23(3)19(22(35)25-10-16(30)31)27-20(33)11(2)26-21(34)17(24-4)18(32)12-8-14(37-23)13(29)9-15(12)38(36)7-6-28/h8-9,11,17-19,24,28-29,32H,5-7,10H2,1-4H3,(H,25,35)(H,26,34)(H,27,33)(H,30,31) |
| InChIKey | GLUWKRSBTMPQNR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ustilaginoidea virens (ncbitaxon:1159556) | - | PubMed (8071121) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ustiloxin C (CHEBI:176049) is a oligopeptide (CHEBI:25676) |
| IUPAC Names |
|---|
| 2-[[3-ethyl-11,15-dihydroxy-13-(2-hydroxyethylsulinyl)-3,7-dimethyl-10-(methylamino)-6,9-dioxo-2-oxa-5,8-diazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene-4-carbonyl]amino]acetic acid |
| 2-[[(3R,4S,7S,10S,11R)-3-ethyl-11,15-dihydroxy-13-[(R)-2-hydroxyethylsulinyl]-3,7-dimethyl-10-(methylamino)-6,9-dioxo-2-oxa-5,8-diazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene-4-carbonyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 138879 | ChemSpider |
| 8183500 | ChemSpider |
| HMDB0041053 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:158274-98-7 | ChemIDplus |