EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O7 |
| Net Charge | 0 |
| Average Mass | 406.475 |
| Monoisotopic Mass | 406.19915 |
| SMILES | COc1cc(CCC(O)CC(O)CCc2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H30O7/c1-27-19-10-14(6-9-18(19)25)4-7-16(23)13-17(24)8-5-15-11-20(28-2)22(26)21(12-15)29-3/h6,9-12,16-17,23-26H,4-5,7-8,13H2,1-3H3 |
| InChIKey | UEKHBUNMFZUBFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-Hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)-3,5-heptanediol (CHEBI:176008) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol |
| Manual Xrefs | Databases |
|---|---|
| 23254830 | ChemSpider |
| HMDB0041091 | HMDB |