EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O7 |
| Net Charge | 0 |
| Average Mass | 398.411 |
| Monoisotopic Mass | 398.13655 |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H22O7/c1-27-19-10-14(6-9-18(19)25)4-7-16(23)13-17(24)8-5-15-11-20(28-2)22(26)21(12-15)29-3/h4-12,25-26H,13H2,1-3H3/b7-4+,8-5+ |
| InChIKey | MQJGAHXKAZGEGI-NSLJXJERSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-Methoxycurcumin (CHEBI:175974) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1E,6E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 8425735 | ChemSpider |
| HMDB0038921 | HMDB |