EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26F2O5 |
| Net Charge | 0 |
| Average Mass | 396.430 |
| Monoisotopic Mass | 396.17483 |
| SMILES | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)O |
| InChI | InChI=1S/C21H26F2O5/c1-10-6-12-13-8-15(22)14-7-11(24)4-5-18(14,2)20(13,23)16(25)9-19(12,3)21(10,28)17(26)27/h4-5,7,10,12-13,15-16,25,28H,6,8-9H2,1-3H3,(H,26,27) |
| InChIKey | QSVBUQTYFQFEHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluticasone 17beta-carboxylic acid (CHEBI:175973) has role androgen (CHEBI:50113) |
| fluticasone 17beta-carboxylic acid (CHEBI:175973) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| 6,9-diluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 3583445 | ChemSpider |