EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O6 |
| Net Charge | 0 |
| Average Mass | 386.444 |
| Monoisotopic Mass | 386.17294 |
| SMILES | COc1cc(CC/C=C/C(=O)CCc2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H26O6/c1-26-19-12-15(9-11-18(19)24)6-4-5-7-17(23)10-8-16-13-20(27-2)22(25)21(14-16)28-3/h5,7,9,11-14,24-25H,4,6,8,10H2,1-3H3/b7-5+ |
| InChIKey | GCCMDTDROAUVAS-FNORWQNLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isogingerenone B (CHEBI:175922) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 4477110 | ChemSpider |
| HMDB0035404 | HMDB |