EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O7 |
| Net Charge | 0 |
| Average Mass | 386.400 |
| Monoisotopic Mass | 386.13655 |
| SMILES | COc1cc(/C=C\C(=O)CC(=O)CC(O)c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H22O7/c1-27-20-9-13(4-7-17(20)24)3-6-15(22)11-16(23)12-19(26)14-5-8-18(25)21(10-14)28-2/h3-10,19,24-26H,11-12H2,1-2H3/b6-3- |
| InChIKey | NKDVMZOMVJQUDC-UTCJRWHESA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)-1-heptene-3,5-dione (CHEBI:175920) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (Z)-7-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040355 | HMDB |
| 35014933 | ChemSpider |