EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O7 |
| Net Charge | 0 |
| Average Mass | 384.384 |
| Monoisotopic Mass | 384.12090 |
| SMILES | COc1cc(/C=C/C(=O)COC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H20O7/c1-26-19-11-14(4-8-17(19)23)3-7-16(22)13-28-21(25)10-6-15-5-9-18(24)20(12-15)27-2/h3-12,23-24H,13H2,1-2H3/b7-3+,10-6+ |
| InChIKey | UYEWRTKHKAVRDI-ASVGJQBISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calebin A (CHEBI:175904) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [(E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 553044 | ChemSpider |
| HMDB0040134 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:336784-82-8 | ChemIDplus |