EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O7 |
| Net Charge | 0 |
| Average Mass | 378.421 |
| Monoisotopic Mass | 378.16785 |
| SMILES | C=C1CC23CC1(O)CCC2C1(C=O)CC(O)CC(C)(C(=O)O)C1C3C(=O)O |
| InChI | InChI=1S/C20H26O7/c1-10-5-18-8-20(10,27)4-3-12(18)19(9-21)7-11(22)6-17(2,16(25)26)14(19)13(18)15(23)24/h9,11-14,22,27H,1,3-8H2,2H3,(H,23,24)(H,25,26) |
| InChIKey | CUTYINBLQKKDCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gibberellin A99 (CHEBI:175856) is a C20-gibberellin (CHEBI:20859) |
| IUPAC Name |
|---|
| 8-ormyl-6,12-dihydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 35015135 | ChemSpider |
| HMDB0041231 | HMDB |