EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O8 |
| Net Charge | 0 |
| Average Mass | 378.377 |
| Monoisotopic Mass | 378.13147 |
| SMILES | C=C1C(O)C23CC1(O)C(O)CC2C12C=CC(O)C(C)(C(=O)O1)C2C3C(=O)O |
| InChI | InChI=1S/C19H22O8/c1-7-13(22)17-6-18(7,26)10(21)5-8(17)19-4-3-9(20)16(2,15(25)27-19)12(19)11(17)14(23)24/h3-4,8-13,20-22,26H,1,5-6H2,2H3,(H,23,24) |
| InChIKey | AASAENAURCLYSI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gibberellin A32 (CHEBI:175848) is a C19-gibberellin (CHEBI:20858) |
| Gibberellin A32 (CHEBI:175848) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| IUPAC Name |
|---|
| 4,5,7,12-tetrahydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 35013818 | ChemSpider |
| HMDB0035037 | HMDB |