EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O8 |
| Net Charge | 0 |
| Average Mass | 374.345 |
| Monoisotopic Mass | 374.10017 |
| SMILES | COC(=O)[C@@H](Cc1ccc(O)c(O)c1)OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H18O8/c1-26-19(25)17(10-12-3-6-14(21)16(23)9-12)27-18(24)7-4-11-2-5-13(20)15(22)8-11/h2-9,17,20-23H,10H2,1H3/b7-4+/t17-/m1/s1 |
| InChIKey | XHALVRQBZGZHFE-BBOMDTFKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl rosmarinate (CHEBI:175804) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| methyl (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoate |
| Manual Xrefs | Databases |
|---|---|
| 4980755 | ChemSpider |