EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O6 |
| Net Charge | 0 |
| Average Mass | 368.385 |
| Monoisotopic Mass | 368.12599 |
| SMILES | COc1cc(/C=C/C2=CC(=O)CC(c3ccc(O)c(OC)c3)O2)ccc1O |
| InChI | InChI=1S/C21H20O6/c1-25-20-9-13(4-7-17(20)23)3-6-16-11-15(22)12-19(27-16)14-5-8-18(24)21(10-14)26-2/h3-11,19,23-24H,12H2,1-2H3/b6-3+ |
| InChIKey | IZLBLUIBVMGMIY-ZZXKWVIFSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclocurcumin (CHEBI:175723) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 2-(4-hydroxy-3-methoxyphenyl)-6-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-2,3-dihydropyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033086 | HMDB |
| 32818602 | ChemSpider |