EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O9 |
| Net Charge | 0 |
| Average Mass | 368.338 |
| Monoisotopic Mass | 368.11073 |
| SMILES | COC1(C(=O)O)CC(O)C(O)C(OC(=O)/C=C\c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C17H20O9/c1-25-17(16(23)24)7-12(20)15(22)13(8-17)26-14(21)5-3-9-2-4-10(18)11(19)6-9/h2-6,12-13,15,18-20,22H,7-8H2,1H3,(H,23,24)/b5-3- |
| InChIKey | NRRBIAVXVIGMKC-HYXAFXHYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-Caffeoyl-1-O-methylquinic acid (CHEBI:175715) is a quinic acid (CHEBI:26493) |
| IUPAC Name |
|---|
| 3-[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-4,5-dihydroxy-1-methoxycyclohexane-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039959 | HMDB |
| 35014902 | ChemSpider |