EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O5 |
| Net Charge | 0 |
| Average Mass | 460.655 |
| Monoisotopic Mass | 460.31887 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@H](O)C[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@@H](C(=C)[C@H](O)C[C@H](C)C(C)C)CC[C@@]3(O)C1=CC2=O |
| InChI | InChI=1S/C28H44O5/c1-15(2)16(3)11-22(29)17(4)18-8-10-28(33)20-12-23(30)21-13-24(31)25(32)14-26(21,5)19(20)7-9-27(18,28)6/h12,15-16,18-19,21-22,24-25,29,31-33H,4,7-11,13-14H2,1-3,5-6H3/t16-,18+,19-,21-,22+,24+,25-,26+,27+,28+/m0/s1 |
| InChIKey | RHWDQPXMKCQCKR-IWEPWQGWSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Polyporusterone D (CHEBI:175655) has role androgen (CHEBI:50113) |
| Polyporusterone D (CHEBI:175655) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (2S,3R,5R,9R,10R,13R,14S,17R)-2,3,14-trihydroxy-17-[(3R,5S)-3-hydroxy-5,6-dimethylhept-1-en-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| Manual Xrefs | Databases |
|---|---|
| 24698347 | ChemSpider |