EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O7 |
| Net Charge | 0 |
| Average Mass | 362.378 |
| Monoisotopic Mass | 362.13655 |
| SMILES | C=C1CC23CC1(O)CCC2C12CCCC(C(=O)O)(C(=O)O1)C2C3C(=O)O |
| InChI | InChI=1S/C19H22O7/c1-9-7-16-8-17(9,25)6-3-10(16)19-5-2-4-18(14(22)23,15(24)26-19)12(19)11(16)13(20)21/h10-12,25H,1-8H2,(H,20,21)(H,22,23) |
| InChIKey | HILUWRPVFKJTAD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gibberellin A21 (CHEBI:175643) is a C19-gibberellin (CHEBI:20858) |
| Gibberellin A21 (CHEBI:175643) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| IUPAC Name |
|---|
| 5-hydroxy-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9,11-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 35013829 | ChemSpider |
| HMDB0035050 | HMDB |