EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O5 |
| Net Charge | 0 |
| Average Mass | 454.607 |
| Monoisotopic Mass | 454.27192 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)[C@@]3([H])CC(C)=C(C)C(=O)O3)[C@@]1(C)CC[C@]1([H])[C@@]3(C)C(=O)C=CC[C@]3(O)[C@H]3O[C@H]3[C@@]21[H] |
| InChI | InChI=1S/C28H38O5/c1-14-13-20(32-25(30)15(14)2)16(3)17-8-9-18-22-19(10-12-26(17,18)4)27(5)21(29)7-6-11-28(27,31)24-23(22)33-24/h6-7,16-20,22-24,31H,8-13H2,1-5H3/t16-,17+,18-,19-,20+,22-,23-,24-,26+,27-,28-/m0/s1 |
| InChIKey | ZTEVDTFJUUJBLP-MBMSZCMESA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Withanolide B (CHEBI:175627) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1S,2S,4S,5R,10R,11S,14R,15R,18S)-15-[(1S)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-5-hydroxy-10,14-dimethyl-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-7-en-9-one |
| Manual Xrefs | Databases |
|---|---|
| 10247854 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:56973-41-2 | ChemIDplus |