EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26NO4 |
| Net Charge | +1 |
| Average Mass | 356.442 |
| Monoisotopic Mass | 356.18563 |
| SMILES | [H][C@]12Cc3cc(O)c(OC)cc3-c3c(OC)c(OC)cc(c31)CC[N+]2(C)C |
| InChI | InChI=1S/C21H25NO4/c1-22(2)7-6-12-10-18(25-4)21(26-5)20-14-11-17(24-3)16(23)9-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/p+1/t15-/m0/s1 |
| InChIKey | FGUCOPALAZXICJ-HNNXBMFYSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xanthoplanine (CHEBI:175585) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| (6aS)-1,2,10-trimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-9-ol |
| Manual Xrefs | Databases |
|---|---|
| 25042175 | ChemSpider |