EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O6 |
| Net Charge | 0 |
| Average Mass | 354.358 |
| Monoisotopic Mass | 354.11034 |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(O)c2)ccc1O |
| InChI | InChI=1S/C20H18O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)12-15(21)6-2-13-4-8-17(23)19(25)10-13/h2-11,23-25H,12H2,1H3/b6-2+,7-3+ |
| InChIKey | FFRFJIZJLZXEJX-YPCIICBESA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(3,4-Dihydroxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione (CHEBI:175540) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1E,6E)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 4579943 | ChemSpider |
| HMDB0033877 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:149732-51-4 | ChemIDplus |