EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17548 - alginic acid
| Formula | (C6H8O6)n.H2O |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | [H]O[C@@H]1C(C(=O)O)O[C@@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a112xA-1u_1-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3-,4?,6+/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-QTWKXLRFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alginic acid (CHEBI:17548) has role analgesic (CHEBI:35480) |
| alginic acid (CHEBI:17548) has role anti-obesity agent (CHEBI:74518) |
| alginic acid (CHEBI:17548) has role anti-ulcer drug (CHEBI:49201) |
| alginic acid (CHEBI:17548) has role hematologic agent (CHEBI:50248) |
| alginic acid (CHEBI:17548) is a copolymer macromolecule (CHEBI:53310) |
| alginic acid (CHEBI:17548) is a exopolysaccharide (CHEBI:72813) |
| alginic acid (CHEBI:17548) is a heteroglycan (CHEBI:16966) |
| alginic acid (CHEBI:17548) is conjugate acid of alginate (CHEBI:58187) |
| Incoming Relation(s) |
| alginate (CHEBI:58187) is conjugate base of alginic acid (CHEBI:17548) |
| INN | Source |
|---|---|
| alginic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| Acidum alginicum | ChEMBL |
| Alginate | KEGG COMPOUND |
| (Alginate)n | KEGG COMPOUND |
| (Alginate)n+1 | KEGG COMPOUND |
| Alginic acid | KEGG COMPOUND |
| E-400 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| Alginic_acid | Wikipedia |
| C01768 | KEGG COMPOUND |
| D02324 | KEGG DRUG |
| G10593 | KEGG GLYCAN |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8192143 | Beilstein |
| CAS:9005-32-7 | KEGG COMPOUND |
| CAS:9005-32-7 | ChemIDplus |
| CAS:9005-32-7 | KEGG DRUG |
| Citations |
|---|