EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O8 |
| Net Charge | 0 |
| Average Mass | 350.323 |
| Monoisotopic Mass | 350.10017 |
| SMILES | [H][C@@]12C[C@@](O)(C[C@@H](O)[C@H]1OC(=O)/C=C/c1ccc(O)c(OC)c1)C(=O)O2 |
| InChI | InChI=1S/C17H18O8/c1-23-12-6-9(2-4-10(12)18)3-5-14(20)25-15-11(19)7-17(22)8-13(15)24-16(17)21/h2-6,11,13,15,18-19,22H,7-8H2,1H3/b5-3+/t11-,13-,15-,17+/m1/s1 |
| InChIKey | OIGFDFULTVHQNZ-KJJWLSQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Feruloyl-1,5-quinolactone (CHEBI:175471) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [(1S,3R,4R,5R)-1,3-dihydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 30776760 | ChemSpider |
| HMDB0029290 | HMDB |