EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | [H][C@@]12[C@@H](O)CC3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@]1([H])C3(C)C(=O)O[C@]21C=C[C@@H]3O |
| InChI | InChI=1S/C19H22O6/c1-8-6-18-7-9(8)5-10(20)13(18)19-4-3-11(21)17(2,16(24)25-19)14(19)12(18)15(22)23/h3-4,9-14,20-21H,1,5-7H2,2H3,(H,22,23)/t9?,10-,11-,12+,13+,14+,17?,18+,19+/m0/s1 |
| InChIKey | ITIKZMJAVWOFFK-PCYCALGTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11beta-Hydroxygibberellin A7 (CHEBI:175392) is a C19-gibberellin (CHEBI:20858) |
| 11beta-Hydroxygibberellin A7 (CHEBI:175392) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| IUPAC Name |
|---|
| (1S,2S,3S,8R,9S,10R,12S)-3,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |