EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O6 |
| Net Charge | 0 |
| Average Mass | 412.442 |
| Monoisotopic Mass | 412.16344 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)NCCCCNC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H24N2O6/c25-17-7-3-15(13-19(17)27)5-9-21(29)23-11-1-2-12-24-22(30)10-6-16-4-8-18(26)20(28)14-16/h3-10,13-14,25-28H,1-2,11-12H2,(H,23,29)(H,24,30)/b9-5+,10-6+ |
| InChIKey | WKIWXOKCKNMLIX-NXZHAISVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dicaffeoylputrescine (CHEBI:175300) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(3,4-dihydroxyphenyl)-N-[4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 9713619 | ChemSpider |
| HMDB0033467 | HMDB |